Harding Mine, Picuris District, Taos County, New Mexico, USAi
| Regional Level Types | |
|---|---|
| Harding Mine | Mine |
| Picuris District | Mining District |
| Taos County | County |
| New Mexico | State |
| USA | Country |
This page kindly sponsored by Taos Rockers
Latitude & Longitude (WGS84):
36° 11' 35'' North , 105° 47' 40'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Mindat Locality ID:
13724
Long-form identifier:
mindat:1:2:13724:6
GUID (UUID V4):
60901f3a-cf53-4921-89b8-15c4490281e4
Other/historical names associated with this locality:
Harding Pegmatite; Harding Pegmatite Mine
A Ta-Be-Li-Sn occurrence/mine in pegmatite located in the EΒ½SWΒΌ sec. 29, T23N, R11E, NMM, in the western part of the Picuris Range, about 20 miles (ca. 32 km) SW of Taos. Discovered in 1900 and first produced in 1920. Previously owned by Arthur Montgomery (100%) (1975). Owned by the University of New Mexico (from whom permission to collect is required). The USGS MRDS database stated accuracy for this location is 10 meters.
Mineralization is a tabular, zoned pegmatite dike hosted in schist and quartzite. The orebody strikes N45W and dips 6S at a thickness of 17 meters, width of 91 meters and length of 914 meters, covering an area of 10 hectares, and with a depth-to-top of 0 meters. Orebody No. 1 is an irregular pegmatite and orebody No. 2 is a replacement body. The primary mode of origin was magmatic differentiation. Primary ore control was igneous, and the secondary control was fracturing. This pegmatite has the largest occurrence of microlite in the U.S. Local rocks include metamorphic rocks.
This pegmatite was mined for its lepidolite, spodumene, beryl, and microlite. The outer pegmatite is complex and contains quartz-microcline-muscovite-albite facies. The inner zone contains tantalum-lithium minerals. Cassiterite found as a minor occurrence. One 30-ton microlite concentrate contained 0.23% cassiterite.
Workings include surface and underground openings comprised of a large open cut and underground workings. The mining was a quarry operation (approximately 40,000 tons), but in the center of the South face, it was mined underground by the room and pillar method. The U.S. Bureau of Mines extensively drilled the pegmatite during the late 1930s and early 1940s.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
66 valid minerals. 2 erroneous literature entries.
Detailed Mineral List:
| β Alabandite Formula: MnS |
| β Albite Formula: Na(AlSi3O8) |
| β Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| β Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| β Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) References: |
| β 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| β Almandine Formula: Fe2+3Al2(SiO4)3 Colour: wine-red |
| β Amblygonite ? Formula: LiAl(PO4)F |
| β Andalusite Formula: Al2(SiO4)O Description: small gray masses as residua in country-rock metacrysts |
| β Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| β Azurite Formula: Cu3(CO3)2(OH)2 |
| β Bertrandite Formula: Be4(Si2O7)(OH)2 |
| β Beryl Formula: Be3Al2(Si6O18) References: |
| β Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| β Beryl var. Morganite Formula: Be3Al2(Si6O18) |
| β Beyerite Formula: Ca(BiO)2(CO3)2 |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Bismite Formula: Bi2O3 |
| β Bismuth Formula: Bi |
| β Bismuthinite Formula: Bi2S3 |
| β Bismutite Formula: (BiO)2CO3 |
| β Bismutotantalite Formula: Bi(Ta,Nb)O4 |
| β Bityite Formula: CaLiAl2(AlBeSi2O10)(OH)2 Fluorescence: SW- medium creamy yellow |
| β Calcite Formula: CaCO3 |
| β Cassiterite ? Formula: SnO2 |
| β Chalcocite Formula: Cu2S |
| β Chalcopyrite Formula: CuFeS2 |
| β Chloritoid Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 Description: Thin, broad plates in country-rock schists |
| β Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Columbite-(Mn) Formula: Mn2+Nb2O6 |
| β 'Columbite-Tantalite' |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) Description: Gray metacrysts in country-rock schist |
| β Danalite Formula: Be3Fe2+4(SiO4)3S |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β Eucryptite Formula: LiAlSiO4 Description: finegrained alteration crust of spodumene (together with quartz, micas and albite); Earthy white facture fillings |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Fluorapatite var. Manganese-bearing Fluorapatite Formula: (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) References: |
| β Fluorcalciomicrolite Formula: (Ca,Na)2(Ta,Nb)2O6F |
| β Fluorite Formula: CaF2 |
| β Gahnite Formula: ZnAl2O4 |
| β Holmquistite Formula: ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 Description: Tiny needles locally along pegmatite contacts |
| β 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β Ilmenite Formula: Fe2+TiO3 |
| β Kaolinite Formula: Al2(Si2O5)(OH)4 |
| β 'Lepidolite' References: |
| β 'Limonite' |
| β 'Lithian Muscovite' Formula: KAl2(AlSi3O10)(OH)2 |
| β Lithiophilite Formula: LiMn2+PO4 |
| β LΓΆllingite Formula: FeAs2 |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Malachite Formula: Cu2(CO3)(OH)2 |
| β 'Manganese Oxides' References: |
| β 'Manganese Oxides var. Manganese Dendrites' References: |
| β Microcline Formula: K(AlSi3O8) |
| β 'Microlite Group' Formula: A2-mTa2X6-wZ-n |
| β 'Monazite' Formula: REE(PO4) |
| β Monazite-(Ce) Formula: Ce(PO4) References: |
| β Montebrasite Formula: LiAl(PO4)(OH) References: |
| β Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| β Mottramite Formula: PbCu(VO4)(OH) References: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| β Orthoclase Formula: K(AlSi3O8) |
| β Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| β Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) Description: Not found in the Harding Pegmatite, but is reported in the Picuris Mountains. |
| β Pucherite Formula: Bi(VO4) Colour: orange Description: drusy crystals |
| β Pyrite Formula: FeS2 |
| β 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z |
| β 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' Formula: (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| β Formula: Mn4+O2 Description: Pyrolusite does not exist in dendrite form. (Potter and Rossman, 1979). |
| β Pyrophyllite Formula: Al2Si4O10(OH)2 |
| β Quartz Formula: SiO2 |
| β Quartz var. Smoky Quartz Formula: SiO2 |
| β Roscoelite Formula: K(V3+,Al)2(AlSi3O10)(OH)2 |
| β Rutile Formula: TiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 |
| β Spodumene Formula: LiAlSi2O6 References: |
| β 'Tantalite' Formula: (Mn,Fe)(Ta,Nb)2O6 |
| β Tantalite-(Mn) Formula: Mn2+Ta2O6 Colour: mahogney-brown Description: 0,3-to 1,5 inch tablets |
| β Tenorite Formula: CuO |
| β Thorite Formula: Th(SiO4) |
| β Titanite Formula: CaTi(SiO4)O |
| β Topaz Formula: Al2(SiO4)(F,OH)2 |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| β Vanadinite Formula: Pb5(VO4)3Cl |
| β 'Wad' |
| β Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O |
| β Zircon Formula: Zr(SiO4) |
| β Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| β Zoisite var. Thulite Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
Gallery:
(Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH)β Fluorapatite var. Manganese-bearing Fluorapatite
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Alabandite | 2.CD.10 | MnS |
| β | Bismuthinite | 2.DB.05 | Bi2S3 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | LΓΆllingite | 2.EB.15a | FeAs2 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| β | '' | 4.00. | A2Nb2(O,OH)6Z |
| β | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| β | Tenorite | 4.AB.10 | CuO |
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Bismite | 4.CB.60 | Bi2O3 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | var. Smoky Quartz | 4.DA.05 | SiO2 |
| β | Pyrolusite ? | 4.DB.05 | Mn4+O2 |
| β | Cassiterite ? | 4.DB.05 | SnO2 |
| β | Rutile | 4.DB.05 | TiO2 |
| β | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| β | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| β | Bismutotantalite | 4.DE.30 | Bi(Ta,Nb)O4 |
| β | Fluorcalciomicrolite | 4.DH.15 | (Ca,Na)2(Ta,Nb)2O6F |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| β | Bismutite | 5.BE.25 | (BiO)2CO3 |
| β | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Pickeringite | 7.CB.85 | MgAl2(SO4)4 Β· 22H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| β | Pucherite | 8.AD.40 | Bi(VO4) |
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| β | Amblygonite ? | 8.BB.05 | LiAl(PO4)F |
| β | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| β | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| β | Fluorapatite var. Manganese-bearing Fluorapatite | 8.BN.05 | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| β | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 Β· 5H2O |
| Group 9 - Silicates | |||
| β | Eucryptite | 9.AA.05 | LiAlSiO4 |
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Thorite | 9.AD.30 | Th(SiO4) |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Chloritoid | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| β | Titanite | 9.AG.15 | CaTi(SiO4)O |
| β | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| β | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| β | Piemontite ? | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| β | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| β | Zoisite var. Thulite | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| β | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| β | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| β | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| β | 9.CJ.05 | Be3Al2(Si6O18) | |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| β | Holmquistite | 9.DD.05 | β»{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| β | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| β | Roscoelite | 9.EC.15 | K(V3+,Al)2(AlSi3O10)(OH)2 |
| β | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| β | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| β | Bityite | 9.EC.35 | CaLiAl2(AlBeSi2O10)(OH)2 |
| β | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 Β· nH2O |
| β | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| β | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 Β· nH2O, x < 1 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| β | 9.FA.35 | Na(AlSi3O8) | |
| β | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| β | Danalite | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| Unclassified | |||
| β | 'Lithian Muscovite' | - | KAl2(AlSi3O10)(OH)2 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| β | 'Columbite-Tantalite' | - | |
| β | 'Manganese Oxides var. Manganese Dendrites' | - | |
| β | '' | - | |
| β | 'Hornblende Root Name Group' | - | β»Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| β | 'Limonite' | - | |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Wad' | - | |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| β | 'Lepidolite' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Monazite' | - | REE(PO4) |
| β | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Bertrandite | Be4(Si2O7)(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| H | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | β Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| H | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | β Kaolinite | Al2(Si2O5)(OH)4 |
| H | β Malachite | Cu2(CO3)(OH)2 |
| H | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| H | β Montebrasite | LiAl(PO4)(OH) |
| H | β Mottramite | PbCu(VO4)(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | β Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | β Pyrophyllite | Al2Si4O10(OH)2 |
| H | β Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| H | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| H | β Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | β Amblygonite | LiAl(PO4)F |
| Li | β Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Eucryptite | LiAlSiO4 |
| Li | β Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Li | β Lithiophilite | LiMn2+PO4 |
| Li | β Montebrasite | LiAl(PO4)(OH) |
| Li | β Spodumene | LiAlSi2O6 |
| Be | Beryllium | |
| Be | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | β Bertrandite | Be4(Si2O7)(OH)2 |
| Be | β Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Danalite | Be3Fe42+(SiO4)3S |
| Be | β Beryl var. Morganite | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Beyerite | Ca(BiO)2(CO3)2 |
| C | β Bismutite | (BiO)2CO3 |
| C | β Calcite | CaCO3 |
| C | β Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | β Amblygonite | LiAl(PO4)F |
| O | β Andalusite | Al2(SiO4)O |
| O | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Bertrandite | Be4(Si2O7)(OH)2 |
| O | β Beyerite | Ca(BiO)2(CO3)2 |
| O | β Bismutotantalite | Bi(Ta,Nb)O4 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Bismite | Bi2O3 |
| O | β Bismutite | (BiO)2CO3 |
| O | β Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Calcite | CaCO3 |
| O | β Cassiterite | SnO2 |
| O | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Danalite | Be3Fe42+(SiO4)3S |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | β Eucryptite | LiAlSiO4 |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Gahnite | ZnAl2O4 |
| O | β Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| O | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Kaolinite | Al2(Si2O5)(OH)4 |
| O | β Lithiophilite | LiMn2+PO4 |
| O | β Columbite-(Mn) | Mn2+Nb2O6 |
| O | β Tantalite-(Mn) | Mn2+Ta2O6 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Malachite | Cu2(CO3)(OH)2 |
| O | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite | REE(PO4) |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Montebrasite | LiAl(PO4)(OH) |
| O | β Beryl var. Morganite | Be3Al2(Si6O18) |
| O | β Mottramite | PbCu(VO4)(OH) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | β Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | β Pucherite | Bi(VO4) |
| O | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | β Pyrolusite | Mn4+O2 |
| O | β Pyrophyllite | Al2Si4O10(OH)2 |
| O | β Quartz | SiO2 |
| O | β Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| O | β Rutile | TiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Quartz var. Smoky Quartz | SiO2 |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Spodumene | LiAlSi2O6 |
| O | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | β Tenorite | CuO |
| O | β Thorite | Th(SiO4) |
| O | β Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | β Titanite | CaTi(SiO4)O |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| O | β Vanadinite | Pb5(VO4)3Cl |
| O | β Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | β Zircon | Zr(SiO4) |
| O | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | β Albite var. Cleavelandite | Na(AlSi3O8) |
| O | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | β Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
| O | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | β Amblygonite | LiAl(PO4)F |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Fluorite | CaF2 |
| F | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| F | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| F | β Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | β Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | β Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
| Mg | Magnesium | |
| Mg | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | β Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Mg | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | β Amblygonite | LiAl(PO4)F |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | β Eucryptite | LiAlSiO4 |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Al | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | β Kaolinite | Al2(Si2O5)(OH)4 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Montebrasite | LiAl(PO4)(OH) |
| Al | β Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | β Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | β Pyrophyllite | Al2Si4O10(OH)2 |
| Al | β Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Spodumene | LiAlSi2O6 |
| Al | β Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Al | β Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Al | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Bertrandite | Be4(Si2O7)(OH)2 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Danalite | Be3Fe42+(SiO4)3S |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | β Eucryptite | LiAlSiO4 |
| Si | β Holmquistite | ◻{Li2}{Mg3Al2}(Si8O22)(OH)2 |
| Si | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | β Kaolinite | Al2(Si2O5)(OH)4 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | β Pyrophyllite | Al2Si4O10(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Quartz var. Smoky Quartz | SiO2 |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Spodumene | LiAlSi2O6 |
| Si | β Thorite | Th(SiO4) |
| Si | β Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | β Titanite | CaTi(SiO4)O |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | β Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | β Amblygonite | LiAl(PO4)F |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Lithiophilite | LiMn2+PO4 |
| P | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| P | β Monazite | REE(PO4) |
| P | β Monazite-(Ce) | Ce(PO4) |
| P | β Montebrasite | LiAl(PO4)(OH) |
| P | β Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Alabandite | MnS |
| S | β Bismuthinite | Bi2S3 |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcocite | Cu2S |
| S | β Danalite | Be3Fe42+(SiO4)3S |
| S | β Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | β Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Cl | β Vanadinite | Pb5(VO4)3Cl |
| Cl | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| K | β Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| K | β Lithian Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | β Beyerite | Ca(BiO)2(CO3)2 |
| Ca | β Bityite | CaLiAl2(AlBeSi2O10)(OH)2 |
| Ca | β Calcite | CaCO3 |
| Ca | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Fluorite | CaF2 |
| Ca | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Ca | β Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | β Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | β Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | β Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | β Titanite | CaTi(SiO4)O |
| Ca | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ca | β Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | β Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | β Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | β Ilmenite | Fe2+TiO3 |
| Ti | β Rutile | TiO2 |
| Ti | β Titanite | CaTi(SiO4)O |
| Ti | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| V | Vanadium | |
| V | β Mottramite | PbCu(VO4)(OH) |
| V | β Pucherite | Bi(VO4) |
| V | β Roscoelite | K(V3+,Al)2(AlSi3O10)(OH)2 |
| V | β Vanadinite | Pb5(VO4)3Cl |
| Mn | Manganese | |
| Mn | β Alabandite | MnS |
| Mn | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mn | β Lithiophilite | LiMn2+PO4 |
| Mn | β Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | β Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | β Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Mn | β Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | β Pyrolusite | Mn4+O2 |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Mn | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | β Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Fe | Iron | |
| Fe | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | β Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | β Danalite | Be3Fe42+(SiO4)3S |
| Fe | β Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β LΓΆllingite | FeAs2 |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcocite | Cu2S |
| Cu | β Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | β Malachite | Cu2(CO3)(OH)2 |
| Cu | β Mottramite | PbCu(VO4)(OH) |
| Cu | β Tenorite | CuO |
| Zn | Zinc | |
| Zn | β Gahnite | ZnAl2O4 |
| As | Arsenic | |
| As | β LΓΆllingite | FeAs2 |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Bismutotantalite | Bi(Ta,Nb)O4 |
| Nb | β Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | β Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nb | β Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Ce | Cerium | |
| Ce | β Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | β Monazite-(Ce) | Ce(PO4) |
| Ce | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ta | Tantalum | |
| Ta | β Bismutotantalite | Bi(Ta,Nb)O4 |
| Ta | β Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | β Microlite Group | A2-mTa2X6-wZ-n |
| Ta | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ta | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ta | β Fluorcalciomicrolite | (Ca,Na)2(Ta,Nb)2O6F |
| Pb | Lead | |
| Pb | β Mottramite | PbCu(VO4)(OH) |
| Pb | β Vanadinite | Pb5(VO4)3Cl |
| Bi | Bismuth | |
| Bi | β Beyerite | Ca(BiO)2(CO3)2 |
| Bi | β Bismutotantalite | Bi(Ta,Nb)O4 |
| Bi | β Bismite | Bi2O3 |
| Bi | β Bismuth | Bi |
| Bi | β Bismuthinite | Bi2S3 |
| Bi | β Bismutite | (BiO)2CO3 |
| Bi | β Pucherite | Bi(VO4) |
| Th | Thorium | |
| Th | β Thorite | Th(SiO4) |
| U | Uranium | |
| U | β Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Harding_Pegmatite_Mine |
|---|---|
| Wikidata ID: | Q49417372 |
| Link to USGS MRDS: | 10272951 |
| Link to USGS MRDS: | 10009174 |
Mindat Articles
The Harding Mine, New Mexico by Rolf LuetckeOther Regions, Features and Areas containing this locality
North America
- Rocky MountainsMountain Range
North America PlateTectonic Plate
- Great Plains DomainDomain
USA
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Just, Evan (1937) Geology and economic features of the pegmatites of Taos and Rio Arriba Counties, New Mexico. Bulletin 13. New Mexico Bureau of Geology and Mineral Resources doi:10.58799/b-13
Harding Mine, Picuris District, Taos County, New Mexico, USA