Eight Mile Park, Eight Mile Park Pegmatite Mining District, Fremont County, Colorado, USAi
| Regional Level Types | |
|---|---|
| Eight Mile Park | Park |
| Eight Mile Park Pegmatite Mining District | Mining District |
| Fremont County | County |
| Colorado | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
38° 29' 29'' North , 105° 20' 16'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| CaΓ±on City | 16,400 (2013) | 10.0km |
| Lincoln Park | 3,546 (2011) | 12.4km |
| Brookside | 246 (2017) | 15.3km |
| Williamsburg | 656 (2017) | 20.3km |
| Rockvale | 498 (2017) | 20.3km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Canon City Geology Club | Canon City, Colorado | 10km |
Mindat Locality ID:
6119
Long-form identifier:
mindat:1:2:6119:6
GUID (UUID V4):
ba6cdc59-e2bd-4f07-9046-842d4d7132d9
Other/historical names associated with this locality:
Eightmile Park
5 mi northwest of Canon City (also known as the Royal Gorge district), comprises a pegmatite district of about 10 square mi in T. 18 S., R. 71 W. It is easily reached via U.S. Highway 50 and the Royal Gorge Road from Canon City. ("Minerals of Colorado, updated & revised", p. 15, by Eckel, Edwin B., 1997). Type locality for natromontebrasite, formerly known as fremontite, after the county.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Albite Formula: Na(AlSi3O8) |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| β Azurite Formula: Cu3(CO3)2(OH)2 |
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beyerite Formula: Ca(BiO)2(CO3)2 |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β Bismutite Formula: (BiO)2CO3 |
| β Calcite Formula: CaCO3 |
| β Cerussite Formula: PbCO3 |
| β Chalcocite Formula: Cu2S |
| β 'Chlorite Group' |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| β Djurleite Formula: Cu31S16 |
| β Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Fluorapatite Formula: Ca5(PO4)3F |
| β Gahnite Formula: ZnAl2O4 |
| β 'Lepidolite' |
| β Magnetite Formula: Fe2+Fe3+2O4 |
| β Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O References: |
| β Microcline Formula: K(AlSi3O8) References: |
| β Monazite-(Ce) Formula: Ce(PO4) |
| β Montebrasite Formula: LiAl(PO4)(OH) |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β 'Natromontebrasite' References: |
| β Parsonsite Formula: Pb2(UO2)(PO4)2 |
| β Quartz Formula: SiO2 References: |
| β Quartz var. Rose Quartz Formula: SiO2 |
| β Samarskite-(Y) Formula: YFe3+Nb2O8 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Silver Formula: Ag |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 |
| β Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| β Triplite Formula: Mn2+2(PO4)F |
| β Upalite Formula: Al(UO2)3(PO4)2O(OH) · 7H2O References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Djurleite | 2.BA.05 | Cu31S16 |
| β | Chalcocite | 2.BA.05 | Cu2S |
| Group 4 - Oxides and Hydroxides | |||
| β | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Quartz var. Rose Quartz | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Cerussite | 5.AB.15 | PbCO3 |
| β | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| β | Bismutite | 5.BE.25 | (BiO)2CO3 |
| β | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| β | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| β | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| β | Parsonsite | 8.EA.10 | Pb2(UO2)(PO4)2 |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| β | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 Β· 6H2O |
| β | Upalite | 8.EC.05 | Al(UO2)3(PO4)2O(OH) Β· 7H2O |
| Group 9 - Silicates | |||
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Natromontebrasite' | - | |
| β | 'Lepidolite' | - | |
| β | 'Chlorite Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Azurite | Cu3(CO3)2(OH)2 |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | β Montebrasite | LiAl(PO4)(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Upalite | Al(UO2)3(PO4)2O(OH) · 7H2O |
| Li | Lithium | |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Montebrasite | LiAl(PO4)(OH) |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Azurite | Cu3(CO3)2(OH)2 |
| C | β Beyerite | Ca(BiO)2(CO3)2 |
| C | β Bismutite | (BiO)2CO3 |
| C | β Calcite | CaCO3 |
| C | β Cerussite | PbCO3 |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Azurite | Cu3(CO3)2(OH)2 |
| O | β Beyerite | Ca(BiO)2(CO3)2 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Bismutite | (BiO)2CO3 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Calcite | CaCO3 |
| O | β Cerussite | PbCO3 |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Gahnite | ZnAl2O4 |
| O | β Magnetite | Fe2+Fe23+O4 |
| O | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Montebrasite | LiAl(PO4)(OH) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Parsonsite | Pb2(UO2)(PO4)2 |
| O | β Quartz | SiO2 |
| O | β Quartz var. Rose Quartz | SiO2 |
| O | β Samarskite-(Y) | YFe3+Nb2O8 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Triplite | Mn22+(PO4)F |
| O | β Upalite | Al(UO2)3(PO4)2O(OH) · 7H2O |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Fluorapatite | Ca5(PO4)3F |
| F | β Triplite | Mn22+(PO4)F |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Montebrasite | LiAl(PO4)(OH) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Al | β Upalite | Al(UO2)3(PO4)2O(OH) · 7H2O |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Quartz var. Rose Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Fluorapatite | Ca5(PO4)3F |
| P | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | β Monazite-(Ce) | Ce(PO4) |
| P | β Montebrasite | LiAl(PO4)(OH) |
| P | β Parsonsite | Pb2(UO2)(PO4)2 |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | β Triplite | Mn22+(PO4)F |
| P | β Upalite | Al(UO2)3(PO4)2O(OH) · 7H2O |
| S | Sulfur | |
| S | β Chalcocite | Cu2S |
| S | β Djurleite | Cu31S16 |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Beyerite | Ca(BiO)2(CO3)2 |
| Ca | β Calcite | CaCO3 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Mn | β Triplite | Mn22+(PO4)F |
| Fe | Iron | |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | β Magnetite | Fe2+Fe23+O4 |
| Fe | β Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | β Azurite | Cu3(CO3)2(OH)2 |
| Cu | β Chalcocite | Cu2S |
| Cu | β Djurleite | Cu31S16 |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | β Gahnite | ZnAl2O4 |
| Y | Yttrium | |
| Y | β Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | Niobium | |
| Nb | β Samarskite-(Y) | YFe3+Nb2O8 |
| Ag | Silver | |
| Ag | β Silver | Ag |
| Ce | Cerium | |
| Ce | β Monazite-(Ce) | Ce(PO4) |
| Pb | Lead | |
| Pb | β Cerussite | PbCO3 |
| Pb | β Parsonsite | Pb2(UO2)(PO4)2 |
| Bi | Bismuth | |
| Bi | β Beyerite | Ca(BiO)2(CO3)2 |
| Bi | β Bismutite | (BiO)2CO3 |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | β Parsonsite | Pb2(UO2)(PO4)2 |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Upalite | Al(UO2)3(PO4)2O(OH) · 7H2O |
Other Regions, Features and Areas containing this locality
North America
- Rocky MountainsMountain Range
North America PlateTectonic Plate
- Great Plains DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
