Packsaddle Mountain, Llano County, Texas, USAi
| Regional Level Types | |
|---|---|
| Packsaddle Mountain | Hill |
| Llano County | County |
| Texas | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
30° 37' 14'' North , 98° 30' 30'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Kingsland | 6,030 (2011) | 7.7km |
| Sunrise Beach Village | 731 (2017) | 9.7km |
| Highland Haven | 452 (2017) | 10.9km |
| Granite Shoals | 5,071 (2017) | 12.4km |
| Buchanan Dam | 1,519 (2011) | 15.2km |
Mindat Locality ID:
42314
Long-form identifier:
mindat:1:2:42314:3
GUID (UUID V4):
d4d276b4-fb84-44bf-9944-d0536f09caa1
A summit located SE of Llano.
Named after the saddle-like appearance provided by twin peaks, Packsaddle Mountain is a landmark hill that stands five miles southwest of Kingsland, Texas in eastern Llano County on State Highway 71 and is of interest to both historians and geologists. In 1873, it was the site of the Packsaddle Mountain Fight, the last major Native American battle in the area. The mountain is now part of a large ranch called Packsaddle Ranch.
It is thought that the Spanish mined the mountain for gold prior to the Texas Revolution and that it was the site of Los Almagres, Jim Bowieβs famous lost mine. Prospecting on Packsaddle Mountain renewed interest in gold mining in Llano County in the 1920s, but with no lasting result.
The mountain was the site of the Packsaddle Mountain Fight with 21 Apache Tribesmen on August 4, 1873, and was the last major Indian battle in the area. The fight on Packsaddle Mountain was precipitated when a woman from the Moss Ranch (in what is now Llano County) came into the ranch house with an arrow sticking out of her side. A party of eight ranchers, including W.B. Moss and his two brothers, was raised to pursue the raiders. They found some twenty-one Apaches encamped on Packsaddle Mountain. In the ensuing fight, at least three tribesmen were killed and three ranchers wounded.
The Texas state historical marker reads "Two and one half miles east on the Packsaddle Mountain, in a battle fought August 4, 1873, Captain J. R. Moss, Stephen B. Moss, William B. Moss, Eli Lloyd, Arch Martin, Pink Ayers, E. D. Harrington and Robert Brown routed a band of Indians thrice their number. The last Apache battle in this region." The Apache tribes had been encroaching Tonkawa tribal areas for some time.
At an elevation of 1,628 feet, the higher of the two summits rises 650 feet above Highway 71. Local topography ranges from flat to rolling to steep, with local escarpments, covered with soils ranging from shallow and stony to deep, fine, sandy loam. Vegetation consists primarily of open stands of live oak and Ashe juniper.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities35 valid minerals.
Detailed Mineral List:
| β Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 References: |
| β Albite Formula: Na(AlSi3O8) |
| β Andalusite Formula: Al2(SiO4)O References: |
| β Bornite Formula: Cu5FeS4 References: |
| β Calcite Formula: CaCO3 References: |
| β Cassiterite Formula: SnO2 References: |
| β Cerussite Formula: PbCO3 References: |
| β Chalcocite Formula: Cu2S References: |
| β Chalcopyrite Formula: CuFeS2 References: |
| β Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) References: |
| β Covellite Formula: CuS References: |
| β Cryptomelane Formula: K(Mn4+7Mn3+)O16 References: |
| β Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Fayalite Formula: Fe2+2SiO4 |
| β Fluorapatite Formula: Ca5(PO4)3F References: |
| β Galena Formula: PbS |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| β Goethite Formula: Ξ±-Fe3+O(OH) |
| β Graphite Formula: C References: |
| β Gypsum Formula: CaSO4 · 2H2O Localities: References: |
| β Hematite Formula: Fe2O3 References: |
| β Ilmenite Formula: Fe2+TiO3 References: |
| β Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| β Marcasite Formula: FeS2 References: |
| β Microcline Formula: K(AlSi3O8) References: |
| β Pyrite Formula: FeS2 References: |
| β Pyrolusite Formula: Mn4+O2 References: |
| β Pyrrhotite Formula: Fe1-xS References: |
| β Quartz Formula: SiO2 References: |
| β Scheelite Formula: Ca(WO4) References: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| β Siderite Formula: FeCO3 |
| β Sulphur Formula: S8 References: |
| β 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S References: |
| β Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z References: |
| β 'Tourmaline var. Achroite' Formula: A(D3)G6(T6O18)(BO3)3X3Z References: |
| β Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 References: |
| β Tschermakite Formula: ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Graphite | 1.CB.05a | C |
| β | Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Bornite | 2.BA.15 | Cu5FeS4 |
| β | Chalcocite | 2.BA.05 | Cu2S |
| β | Chalcopyrite | 2.CB.10a | CuFeS2 |
| β | Covellite | 2.CA.05a | CuS |
| β | Galena | 2.CD.10 | PbS |
| β | Marcasite | 2.EB.10a | FeS2 |
| β | Pyrite | 2.EB.05a | FeS2 |
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 4 - Oxides and Hydroxides | |||
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Hematite | 4.CB.05 | Fe2O3 |
| β | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| β | Pyrolusite | 4.DB.05 | Mn4+O2 |
| β | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| β | Calcite | 5.AB.05 | CaCO3 |
| β | Cerussite | 5.AB.15 | PbCO3 |
| β | Siderite | 5.AB.05 | FeCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| β | Gypsum | 7.CD.40 | CaSO4 Β· 2H2O |
| β | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| β | Scheelite | 7.GA.05 | Ca(WO4) |
| β | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) Β· 12H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| β | Actinolite | 9.DE.10 | β»Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| β | Andalusite | 9.AF.10 | Al2(SiO4)O |
| β | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| β | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Fayalite | 9.AC.05 | Fe2+2SiO4 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Tremolite | 9.DE.10 | β»Ca2Mg5(Si8O22)(OH)2 |
| β | Tschermakite | 9.DE.10 | β»(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Unclassified Minerals, Rocks, etc. | |||
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'var. Achroite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | β Jarosite | KFe33+(SO4)2(OH)6 |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Gypsum | CaSO4 · 2H2O |
| H | β Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| H | β Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | β Calcite | CaCO3 |
| C | β Graphite | C |
| C | β Siderite | FeCO3 |
| C | β Cerussite | PbCO3 |
| C | β Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | Oxygen | |
| O | β Andalusite | Al2(SiO4)O |
| O | β Calcite | CaCO3 |
| O | β Cassiterite | SnO2 |
| O | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | β Fluorapatite | Ca5(PO4)3F |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Hematite | Fe2O3 |
| O | β Microcline | K(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Scheelite | Ca(WO4) |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | β Jarosite | KFe33+(SO4)2(OH)6 |
| O | β Albite | Na(AlSi3O8) |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Siderite | FeCO3 |
| O | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Pyrolusite | Mn4+O2 |
| O | β Tourmaline var. Achroite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Gypsum | CaSO4 · 2H2O |
| O | β Cerussite | PbCO3 |
| O | β Ilmenite | Fe2+TiO3 |
| O | β Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| O | β Cryptomelane | K(Mn74+Mn3+)O16 |
| O | β Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | β Fayalite | Fe22+SiO4 |
| O | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| F | Fluorine | |
| F | β Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | β Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Mg | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Al | Aluminium | |
| Al | β Andalusite | Al2(SiO4)O |
| Al | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | Silicon | |
| Si | β Andalusite | Al2(SiO4)O |
| Si | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Si | β Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | β Fayalite | Fe22+SiO4 |
| Si | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| P | Phosphorus | |
| P | β Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | β Galena | PbS |
| S | β Jarosite | KFe33+(SO4)2(OH)6 |
| S | β Gypsum | CaSO4 · 2H2O |
| S | β Marcasite | FeS2 |
| S | β Covellite | CuS |
| S | β Chalcopyrite | CuFeS2 |
| S | β Chalcocite | Cu2S |
| S | β Bornite | Cu5FeS4 |
| S | β Sulphur | S8 |
| S | β Pyrrhotite | Fe1-xS |
| S | β Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| K | Potassium | |
| K | β Microcline | K(AlSi3O8) |
| K | β Jarosite | KFe33+(SO4)2(OH)6 |
| K | β Cryptomelane | K(Mn74+Mn3+)O16 |
| Ca | Calcium | |
| Ca | β Calcite | CaCO3 |
| Ca | β Fluorapatite | Ca5(PO4)3F |
| Ca | β Scheelite | Ca(WO4) |
| Ca | β Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | β Gypsum | CaSO4 · 2H2O |
| Ca | β Tschermakite | ◻(Ca2)(Mg3Al2)(Al2Si6O22)(OH)2 |
| Ca | β Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ti | Titanium | |
| Ti | β Ilmenite | Fe2+TiO3 |
| Mn | Manganese | |
| Mn | β Pyrolusite | Mn4+O2 |
| Mn | β Cryptomelane | K(Mn74+Mn3+)O16 |
| Fe | Iron | |
| Fe | β Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | β Hematite | Fe2O3 |
| Fe | β Pyrite | FeS2 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Siderite | FeCO3 |
| Fe | β Marcasite | FeS2 |
| Fe | β Chalcopyrite | CuFeS2 |
| Fe | β Ilmenite | Fe2+TiO3 |
| Fe | β Bornite | Cu5FeS4 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Fayalite | Fe22+SiO4 |
| Fe | β Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Cu | Copper | |
| Cu | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | β Covellite | CuS |
| Cu | β Chalcopyrite | CuFeS2 |
| Cu | β Chalcocite | Cu2S |
| Cu | β Bornite | Cu5FeS4 |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | β Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| W | Tungsten | |
| W | β Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | β Galena | PbS |
| Pb | β Cerussite | PbCO3 |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Packsaddle_Mountain_(Llano_County,_Texas) |
|---|---|
| Wikidata ID: | Q7123042 |
Localities in this Region
Other Regions, Features and Areas containing this locality
North America PlateTectonic Plate
- Shawnee DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Packsaddle Mountain, Llano County, Texas, USA