Bancillon stream alluvial deposits, Saint-Ilpize, Brioude, Haute-Loire, Auvergne-Rhône-Alpes, Francei
| Regional Level Types | |
|---|---|
| Bancillon stream alluvial deposits | Alluvials |
| Saint-Ilpize | Commune |
| Brioude | Arrondissement |
| Haute-Loire | Department |
| Auvergne-Rhône-Alpes | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 10' 33'' North , 3° 24' 50'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Blassac | 127 (2016) | 1.2km |
| Chilhac | 196 (2016) | 2.9km |
| Saint-Ilpize | 217 (2016) | 3.0km |
| Lavoûte-Chilhac | 322 (2016) | 3.0km |
| Saint-Privat-du-Dragon | 198 (2016) | 3.1km |
Mindat Locality ID:
221067
Long-form identifier:
mindat:1:2:221067:7
GUID (UUID V4):
bdd17f51-6118-44f5-9193-81656f6462a2
Other/historical names associated with this locality:
Auvergne; Rhône-Alpes
Name(s) in local language(s):
Ruisseau de Bancillon, Saint-Ilpize, Lavoûte-Chilhac, Haute-Loire, Auvergne, France
alluvials
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 References: |
| ⓘ Anatase Formula: TiO2 References: |
| ⓘ Corundum Formula: Al2O3 References: |
| ⓘ Corundum var. Sapphire Formula: Al2O3 References: |
| ⓘ 'Fayalite-Forsterite Series' References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 References: |
| ⓘ 'Leucoxene' References: |
| ⓘ 'Limonite' References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 References: |
| ⓘ 'Monazite' Formula: REE(PO4) References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 References: |
| ⓘ Rutile Formula: TiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O References: |
| ⓘ Titanite Formula: CaTi(SiO4)O References: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) References: |
| ⓘ Zircon Formula: Zr(SiO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Corundum var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | 4.CB.05 | Al2O3 | |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Unclassified | |||
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Si | Silicon | |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ca | Calcium | |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
