Paraguaçu river, Andaraí, Bahia, Brazili
Regional Level Types | |
---|---|
Paraguaçu river | River |
Andaraí | Municipality |
Bahia | State |
Brazil | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
12° 49' 10'' South , 41° 17' 56'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Mindat Locality ID:
203942
Long-form identifier:
mindat:1:2:203942:1
GUID (UUID V4):
60984b7b-36da-4de1-a8ba-1fc19580cef4
Name(s) in local language(s):
Rio Paraguaçu
Diamond placer.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ 'Chlorite Group' |
ⓘ Chrysoberyl Formula: BeAl2O4 |
ⓘ Corundum Formula: Al2O3 |
ⓘ Diamond Formula: C References: |
ⓘ Diaspore Formula: AlO(OH) |
ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ Gold Formula: Au |
ⓘ Hematite Formula: Fe2O3 |
ⓘ Hercynite Formula: Fe2+Al2O4 |
ⓘ Ilmenite Formula: Fe2+TiO3 |
ⓘ 'K Feldspar' |
ⓘ Kyanite Formula: Al2(SiO4)O |
ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
ⓘ Monazite-(Ce) Formula: Ce(PO4) |
ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
ⓘ Quartz Formula: SiO2 |
ⓘ Rutile Formula: TiO2 |
ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ Sillimanite Formula: Al2(SiO4)O |
ⓘ Spinel Formula: MgAl2O4 |
ⓘ Xenotime-(Y) Formula: Y(PO4) |
ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
Group 1 - Elements | |||
---|---|---|---|
ⓘ | Gold | 1.AA.05 | Au |
ⓘ | Diamond | 1.CB.10a | C |
Group 4 - Oxides and Hydroxides | |||
ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
ⓘ | Hematite | 4.CB.05 | Fe2O3 |
ⓘ | Corundum | 4.CB.05 | Al2O3 |
ⓘ | Quartz | 4.DA.05 | SiO2 |
ⓘ | Rutile | 4.DB.05 | TiO2 |
ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
Group 8 - Phosphates, Arsenates and Vanadates | |||
ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
Group 9 - Silicates | |||
ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
Unclassified | |||
ⓘ | 'Chlorite Group' | - | |
ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
ⓘ | 'K Feldspar' | - |
List of minerals for each chemical element
H | Hydrogen | |
---|---|---|
H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
H | ⓘ Diaspore | AlO(OH) |
H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Be | Beryllium | |
Be | ⓘ Chrysoberyl | BeAl2O4 |
B | Boron | |
B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
C | Carbon | |
C | ⓘ Diamond | C |
O | Oxygen | |
O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
O | ⓘ Chrysoberyl | BeAl2O4 |
O | ⓘ Corundum | Al2O3 |
O | ⓘ Diaspore | AlO(OH) |
O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
O | ⓘ Hematite | Fe2O3 |
O | ⓘ Hercynite | Fe2+Al2O4 |
O | ⓘ Ilmenite | Fe2+TiO3 |
O | ⓘ Kyanite | Al2(SiO4)O |
O | ⓘ Magnetite | Fe2+Fe23+O4 |
O | ⓘ Monazite-(Ce) | Ce(PO4) |
O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
O | ⓘ Quartz | SiO2 |
O | ⓘ Rutile | TiO2 |
O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
O | ⓘ Sillimanite | Al2(SiO4)O |
O | ⓘ Spinel | MgAl2O4 |
O | ⓘ Xenotime-(Y) | Y(PO4) |
O | ⓘ Zircon | Zr(SiO4) |
F | Fluorine | |
F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Na | Sodium | |
Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Mg | Magnesium | |
Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Mg | ⓘ Spinel | MgAl2O4 |
Al | Aluminium | |
Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Al | ⓘ Chrysoberyl | BeAl2O4 |
Al | ⓘ Corundum | Al2O3 |
Al | ⓘ Diaspore | AlO(OH) |
Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Al | ⓘ Hercynite | Fe2+Al2O4 |
Al | ⓘ Kyanite | Al2(SiO4)O |
Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Al | ⓘ Sillimanite | Al2(SiO4)O |
Al | ⓘ Spinel | MgAl2O4 |
Si | Silicon | |
Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Si | ⓘ Kyanite | Al2(SiO4)O |
Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Si | ⓘ Quartz | SiO2 |
Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Si | ⓘ Sillimanite | Al2(SiO4)O |
Si | ⓘ Zircon | Zr(SiO4) |
P | Phosphorus | |
P | ⓘ Monazite-(Ce) | Ce(PO4) |
P | ⓘ Xenotime-(Y) | Y(PO4) |
K | Potassium | |
K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
Ca | Calcium | |
Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Ti | Titanium | |
Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Ti | ⓘ Ilmenite | Fe2+TiO3 |
Ti | ⓘ Rutile | TiO2 |
Fe | Iron | |
Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
Fe | ⓘ Hematite | Fe2O3 |
Fe | ⓘ Hercynite | Fe2+Al2O4 |
Fe | ⓘ Ilmenite | Fe2+TiO3 |
Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Y | Yttrium | |
Y | ⓘ Xenotime-(Y) | Y(PO4) |
Zr | Zirconium | |
Zr | ⓘ Zircon | Zr(SiO4) |
Ce | Cerium | |
Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
Au | Gold | |
Au | ⓘ Gold | Au |
Other Regions, Features and Areas containing this locality
South AmericaContinent
South America PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Paraguaçu river, Andaraí, Bahia, Brazil