Huanuni, Pantaleón Dalence Province, Oruro, Boliviai
| Regional Level Types | |
|---|---|
| Huanuni | Town |
| Pantaleón Dalence Province | Province |
| Oruro | Department |
| Bolivia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Huanuni | 15,492 (2013) |
Mindat Locality ID:
14512
Long-form identifier:
mindat:1:2:14512:0
GUID (UUID V4):
ac0f7532-e9c7-401d-8bee-967838f9b72d
Tin mining area.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities91 valid minerals. 2 (TL) - type locality of valid minerals. 2 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: References: |
| ⓘ Aheylite (TL) Formula: (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O Type Locality: Colour: gray blue Description: occurs as tiny micro balls to several mm scattered on matrix. The aheylite blebs are associated with cassiterite and occasionally variscite and/or wavellite micros as well. |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: References: |
| ⓘ Arsenopyrite Formula: FeAsS Localities: References: |
| ⓘ Beidellite Formula: (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Berthierine ? Formula: (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 Localities: |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ 'Buergerite' Formula: Na(Fe3+3)Al6(Si6O18)(BO3)3O3(OH) |
| ⓘ Calcite Formula: CaCO3 Localities: |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 10 localities in this region. References: |
| ⓘ Cassiterite var. Wood Tin Formula: SnO2 References: |
| ⓘ Cervelleite Formula: Ag4TeS Localities: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: References: |
| ⓘ Chalcosiderite Formula: CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ Chamosite Formula: (Fe2+)5Al(Si,Al)4O10(OH,O)8 Localities: References: |
| ⓘ 'Chlorite Group' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ 'Coeruleolactite' |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Cronstedtite Formula: Fe2+2Fe3+((Si,Fe3+)2O5)(OH)4 |
| ⓘ Cylindrite Formula: Pb3Sn4FeSb2S14 Localities: |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Drugmanite Formula: Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Faustite Formula: ZnAl6(PO4)4(OH)8 · 4H2O |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: References: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Franckeite Formula: Fe2+(Pb,Sn2+)6Sn4+2Sb2S14 Localities: References: |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 Localities: |
| ⓘ Freieslebenite Formula: AgPbSbS3 |
| ⓘ Galena Formula: PbS Localities: Pepitos Mine, Huanuni, Pantaleón Dalence Province, Oruro, Bolivia Porvenir mine, Huanuni, Pantaleón Dalence Province, Oruro, Bolivia Huanuni mine, Huanuni, Pantaleón Dalence Province, Oruro, Bolivia Bonanza, Huanuni, Pantaleón Dalence Province, Oruro, Bolivia La Suerte, Huanuni, Pantaleón Dalence Province, Oruro, Bolivia References: |
| ⓘ Gersdorffite Formula: NiAsS |
| ⓘ Gibbsite Formula: Al(OH)3 |
| ⓘ Goethite Formula: α-Fe3+O(OH) |
| ⓘ Greenockite Formula: CdS |
| ⓘ Halloysite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Herzenbergite Formula: SnS |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ Hübnerite Formula: MnWO4 Localities: |
| ⓘ Hydrowoodwardite Formula: (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O Localities: |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Localities: References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 Localities: References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Localities: References: |
| ⓘ 'K Feldspar' |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Ludlamite Formula: Fe2+3(PO4)2 · 4H2O |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Matildite Formula: AgBiS2 Localities: |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Montetrisaite Formula: Cu6(SO4)(OH)10 · 2H2O Localities: References: |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Localities: References: |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 Localities: |
| ⓘ Nikischerite (TL) Formula: Fe2+6Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O Type Locality: |
| ⓘ Opal Formula: SiO2 · nH2O Localities: |
| ⓘ Otavite Formula: CdCO3 |
| ⓘ Owyheeite Formula: Ag3Pb10Sb11S28 |
| ⓘ Pavonite Formula: AgBi3S5 Localities: |
| ⓘ Perhamite Formula: Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| ⓘ Plagionite Formula: Pb5Sb8S17 Localities: References: |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 Localities: |
| ⓘ Pyrargyrite Formula: Ag3SbS3 Localities: References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Localities: |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Formula: SiO2 |
| ⓘ Redgillite Formula: Cu6(SO4)(OH)10 · H2O Localities: References: |
| ⓘ Rhodostannite Formula: Cu1+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ Rutile Formula: TiO2 Localities: References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: References: |
| ⓘ Semseyite Formula: Pb9Sb8S21 Localities: References: |
| ⓘ Siderite Formula: FeCO3 Localities: References: |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 7 localities in this region. References: |
| ⓘ Sphalerite var. Marmatite Formula: (Zn,Fe)S |
| ⓘ Stannite Formula: Cu2FeSnS4 Localities: References: |
| ⓘ Stetindite-(Ce) Formula: Ce(SiO4) |
| ⓘ 'Stibiconite' Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibnite Formula: Sb2S3 Localities: |
| ⓘ Szomolnokite Formula: FeSO4 · H2O |
| ⓘ Teallite Formula: PbSnS2 Localities: References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: References: |
| ⓘ Treasurite Formula: Ag7Pb6Bi15S32 Localities: |
| ⓘ Valentinite Formula: Sb2O3 Localities: References: |
| ⓘ Variscite Formula: AlPO4 · 2H2O |
| ⓘ Formula: Fe2+Al2(PO4)2(OH)2 · 6H2O Localities: |
| ✪ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Wavellite Formula: Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ 'Wolframite Group' |
| ⓘ Wurtzite Formula: (Zn,Fe)S Localities: References: |
| ⓘ Zinkenite ? Formula: Pb9Sb22S42 |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Cervelleite | 2.BA.60 | Ag4TeS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | var. Marmatite | 2.CB.05a | (Zn,Fe)S |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Teallite | 2.CD.05 | PbSnS2 |
| ⓘ | Herzenbergite | 2.CD.05 | SnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Rhodostannite | 2.DA.10 | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Owyheeite | 2.HC.35 | Ag3Pb10Sb11S28 |
| ⓘ | Cylindrite | 2.HF.25a | Pb3Sn4FeSb2S14 |
| ⓘ | Franckeite | 2.HF.25b | Fe2+(Pb,Sn2+)6Sn4+2Sb2S14 |
| ⓘ | Pavonite | 2.JA.05a | AgBi3S5 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| ⓘ | Freieslebenite | 2.JB.15 | AgPbSbS3 |
| ⓘ | Zinkenite ? | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Treasurite | 2.JB.40a | Ag7Pb6Bi15S32 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Smoky Quartz ? | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Cassiterite var. Wood Tin | 4.DB.05 | SnO2 |
| ⓘ | 4.DB.05 | SnO2 | |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | 'Stibiconite' | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Otavite | 5.AB.05 | CdCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Szomolnokite | 7.CB.05 | FeSO4 · H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Hydrowoodwardite | 7.DD.35 | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| ⓘ | Nikischerite (TL) | 7.DD.35 | Fe2+6Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O |
| ⓘ | Redgillite | 7.DD.70 | Cu6(SO4)(OH)10 · H2O |
| ⓘ | Montetrisaite | 7.DD.85 | Cu6(SO4)(OH)10 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Drugmanite | 8.BH.15 | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Variscite | 8.CD.10 | AlPO4 · 2H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Ludlamite | 8.CD.20 | Fe2+3(PO4)2 · 4H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Vauxite ? | 8.DC.35 | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH,F)3 · 5H2O |
| ⓘ | Chalcosiderite | 8.DD.15 | CuFe3+6(PO4)4(OH)8 · 4H2O |
| ⓘ | Faustite | 8.DD.15 | ZnAl6(PO4)4(OH)8 · 4H2O |
| ⓘ | 'Coeruleolactite' | 8.DD.15 | |
| ⓘ | Aheylite (TL) | 8.DD.15 | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| ⓘ | Perhamite | 8.DO.20 | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Stetindite-(Ce) | 9.AD.30 | Ce(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Beidellite | 9.EC.40 | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Halloysite | 9.ED.10 | Al2(Si2O5)(OH)4 |
| ⓘ | Berthierine ? | 9.ED.15 | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Cronstedtite | 9.ED.15 | Fe2+2Fe3+((Si,Fe3+)2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Buergerite' | - | Na(Fe3+3)Al6(Si6O18)(BO3)3O3(OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Szomolnokite | FeSO4 · H2O |
| H | ⓘ Variscite | AlPO4 · 2H2O |
| H | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| H | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| H | ⓘ Nikischerite | Fe62+Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| H | ⓘ Buergerite | Na(Fe33+)Al6(Si6O18)(BO3)3O3(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| B | ⓘ Buergerite | Na(Fe33+)Al6(Si6O18)(BO3)3O3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Otavite | CdCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Otavite | CdCO3 |
| O | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Szomolnokite | FeSO4 · H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Variscite | AlPO4 · 2H2O |
| O | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| O | ⓘ Cassiterite var. Wood Tin | SnO2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| O | ⓘ Nikischerite | Fe62+Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| O | ⓘ Stetindite-(Ce) | Ce(SiO4) |
| O | ⓘ Buergerite | Na(Fe33+)Al6(Si6O18)(BO3)3O3(OH) |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Nikischerite | Fe62+Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O |
| Na | ⓘ Buergerite | Na(Fe33+)Al6(Si6O18)(BO3)3O3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Variscite | AlPO4 · 2H2O |
| Al | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| Al | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| Al | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nikischerite | Fe62+Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O |
| Al | ⓘ Buergerite | Na(Fe33+)Al6(Si6O18)(BO3)3O3(OH) |
| Si | Silicon | |
| Si | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Halloysite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Stetindite-(Ce) | Ce(SiO4) |
| Si | ⓘ Buergerite | Na(Fe33+)Al6(Si6O18)(BO3)3O3(OH) |
| P | Phosphorus | |
| P | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| P | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Variscite | AlPO4 · 2H2O |
| P | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wavellite | Al3(PO4)2(OH,F)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Cervelleite | Ag4TeS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Freieslebenite | AgPbSbS3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Herzenbergite | SnS |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| S | ⓘ Pavonite | AgBi3S5 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Szomolnokite | FeSO4 · H2O |
| S | ⓘ Teallite | PbSnS2 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Treasurite | Ag7Pb6Bi15S32 |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| S | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| S | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| S | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| S | ⓘ Nikischerite | Fe62+Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O |
| S | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Beidellite | (Na,Ca0.5)0.3Al2((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Perhamite | Ca3Al7.7Si3P4O23.5(OH)14.1 · 8H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Fe | Iron | |
| Fe | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Fe | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Cronstedtite | Fe22+Fe3+((Si,Fe3+)2O5)(OH)4 |
| Fe | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Fe | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Szomolnokite | FeSO4 · H2O |
| Fe | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| Fe | ⓘ Nikischerite | Fe62+Al3(OH)18[Na(H2O)6](SO4)2 · 6H2O |
| Fe | ⓘ Buergerite | Na(Fe33+)Al6(Si6O18)(BO3)3O3(OH) |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcosiderite | CuFe63+(PO4)4(OH)8 · 4H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Hydrowoodwardite | (Cu1-xAlx)(OH)2[SO4]x/2 · nH2O |
| Cu | ⓘ Redgillite | Cu6(SO4)(OH)10 · H2O |
| Cu | ⓘ Montetrisaite | Cu6(SO4)(OH)10 · 2H2O |
| Zn | Zinc | |
| Zn | ⓘ Aheylite | (Fe2+,Zn)Al6(PO4)4(OH)8 · 4H2O |
| Zn | ⓘ Faustite | ZnAl6(PO4)4(OH)8 · 4H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Sphalerite var. Marmatite | (Zn,Fe)S |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Cervelleite | Ag4TeS |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Freieslebenite | AgPbSbS3 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Ag | ⓘ Pavonite | AgBi3S5 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Treasurite | Ag7Pb6Bi15S32 |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Otavite | CdCO3 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Sn | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sn | ⓘ Herzenbergite | SnS |
| Sn | ⓘ Rhodostannite | Cu1+(Fe2+0.5Sn4+1.5)S4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sn | ⓘ Teallite | PbSnS2 |
| Sn | ⓘ Cassiterite var. Wood Tin | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Sb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Freieslebenite | AgPbSbS3 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Te | Tellurium | |
| Te | ⓘ Cervelleite | Ag4TeS |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Stetindite-(Ce) | Ce(SiO4) |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hübnerite | MnWO4 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cylindrite | Pb3Sn4FeSb2S14 |
| Pb | ⓘ Drugmanite | Pb2(Fe3+,Al)(PO4)(PO3OH)(OH)2 |
| Pb | ⓘ Franckeite | Fe2+(Pb,Sn2+)6Sn24+Sb2S14 |
| Pb | ⓘ Freieslebenite | AgPbSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Owyheeite | Ag3Pb10Sb11S28 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Teallite | PbSnS2 |
| Pb | ⓘ Treasurite | Ag7Pb6Bi15S32 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
| Bi | Bismuth | |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Pavonite | AgBi3S5 |
| Bi | ⓘ Treasurite | Ag7Pb6Bi15S32 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Oruro
- Pantaleón Dalence Province
Other Regions, Features and Areas that Intersect
Altiplano PlateTectonic Plate
South America
- AndesMountain Range
South America Plate
- Altiplano basinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Huanuni mine, Huanuni, Pantaleón Dalence Province, Oruro, Bolivia