Le Loch beach alluvial deposits, Guidel-Plages, Guidel, Lorient, Morbihan, Brittany, Francei
| Regional Level Types | |
|---|---|
| Le Loch beach alluvial deposits | Alluvials |
| Guidel-Plages | - not defined - |
| Guidel | Commune |
| Lorient | Arrondissement |
| Morbihan | Department |
| Brittany | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° 45' 20'' North , 3° 31' 5'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Guidel-Plage | 9,800 (2016) | 1.3km |
| Clohars-Carnoët | 4,085 (2016) | 6.7km |
| Ploemeur | 20,652 (2016) | 6.8km |
| Gestel | 2,403 (2016) | 7.8km |
| Quéven | 9,316 (2016) | 8.2km |
Mindat Locality ID:
135178
Long-form identifier:
mindat:1:2:135178:4
GUID (UUID V4):
660c5291-f0e5-4f72-b5b3-8113687f0b42
Name(s) in local language(s):
Plage du Loch, Guidel-Plages, Guidel, Morbihan, Bretagne, France
Placer on the beach
Ref :
Chauris L. (1988), Les sables noirs à magnétite de l’anse du Pouldu en Bretagne Méridionale, Géologie de la France, (4), p. 29.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ 'Chlorite Group' |
| ⓘ Chloritoid Formula: (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 References: |
| ⓘ Cuprite Formula: Cu2O References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Glaucophane Formula: ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ Gold Formula: Au |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ 'Leucoxene' References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 References: |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Chloritoid | 9.AF.85 | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Glaucophane | 9.DE.25 | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Unclassified | |||
| ⓘ | 'Leucoxene' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Mg | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | Silicon | |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Monazite | REE(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chloritoid | (Fe2+,Mg,Mn2+)Al2(SiO4)O(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Cu | Copper | |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Le Loch beach alluvial deposits, Guidel-Plages, Guidel, Lorient, Morbihan, Brittany, France