Altscheuer quarries, Lichtenberg, Fischbachtal, Darmstadt-Dieburg, Darmstadt, Hesse, Germanyi
| Regional Level Types | |
|---|---|
| Altscheuer quarries | Group of Quarries |
| Lichtenberg | Quarter |
| Fischbachtal | Municipality |
| Darmstadt-Dieburg | District |
| Darmstadt | Region |
| Hesse | City-State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
49° North , 8° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~3km
Type:
Group of Quarries
Köppen climate type:
Mindat Locality ID:
409701
Long-form identifier:
mindat:1:2:409701:6
GUID (UUID V4):
98c3f7a0-3743-4f4c-821d-64aeb40b586d
Several old quarries on the south-eastern slope of Altscheuer mountain.
At times, pegmatite were exposed.
The α-brass was found as inclusions in albite (Belendorff, 2021).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
12 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ 'Aeschynite' ? |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ 'α-Brass' Formula: Cu3Zn |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuth Formula: Bi |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ 'Bismutopyrochlore (of Chukanov et al.)' ? Formula: (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hydroxycalciopyrochlore Formula: (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | 'α-Brass' | 1.AB.10a | Cu3Zn |
| ⓘ | Bismuth | 1.CA.05 | Bi |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | 'Bismutopyrochlore (of Chukanov et al.)' ? | 4.DH.15 | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| ⓘ | Hydroxycalciopyrochlore | 4.DH.15 | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Aeschynite' ? | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Bismutopyrochlore (of Chukanov et al.) | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| H | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Bismutopyrochlore (of Chukanov et al.) | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| O | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ca | Calcium | |
| Ca | ⓘ Bismutopyrochlore (of Chukanov et al.) | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| Ca | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Ti | Titanium | |
| Ti | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ α-Brass | Cu3Zn |
| Zn | Zinc | |
| Zn | ⓘ α-Brass | Cu3Zn |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Bismutopyrochlore (of Chukanov et al.) | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| Nb | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Pb | Lead | |
| Pb | ⓘ Bismutopyrochlore (of Chukanov et al.) | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismuth | Bi |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Bismutopyrochlore (of Chukanov et al.) | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| U | Uranium | |
| U | ⓘ Bismutopyrochlore (of Chukanov et al.) | (Bi,Ca,U,Pb)2-xNb2(O,OH)6(OH) |
| U | ⓘ Hydroxycalciopyrochlore | (Ca,Na,U,◻)2(Nb,Ti)2O6(OH) |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
