Sommafiume pegmatitic dyke (Alpe Sommafiume; Marategno Mine), Dorio, Lecco Province, Lombardy, Italyi
| Regional Level Types | |
|---|---|
| Sommafiume pegmatitic dyke (Alpe Sommafiume; Marategno Mine) | Vein (Abandoned) |
| Dorio | Commune |
| Lecco Province | Province |
| Lombardy | Region |
| Italy | - not defined - |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° 6' 20'' North , 9° 21' 38'' East
Latitude & Longitude (decimal):
Type:
Vein (Abandoned) - last checked 2023
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Sueglio | 167 (2014) | 3.0km |
| Introzzo | 137 (2014) | 3.1km |
| Colico Piano | 7,204 (2014) | 3.2km |
| Dorio | 323 (2017) | 3.3km |
| Tremenico | 176 (2014) | 3.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Club Cercatori di Minerali e Fossili Ticino | Viganello, Ticino | 32km |
Mindat Locality ID:
29995
Long-form identifier:
mindat:1:2:29995:3
GUID (UUID V4):
dba7193a-8df8-4c77-85d5-4c529828a3fd
Name(s) in local language(s):
Filone pegmatitico di Sommafiume (Alpe Sommafiume; Miniera Marategno), Dervio, Provincia di Lecco, Lombardia, Italia
Abandoned pegmatite quarry (since more than 60 years), also known as Marategno Mine. The mine gallery is located at 982 m a.s.l.
Sommafiume dyke is one of the big 10 dykes of the Piona pegmatite swarm, which is embedded into the high-grade metapelites (sillimanite-, garnet-bearing gneiss) of the Dervio-Olgiasca Zone (DOZ). The DOZ, which belongs to the crystalline basement of the Central Southern Alps, represents a segment of upper to middle continental crust, originated after Variscan intermediate pressure amphibolite facies metamorphism and exumated during the Alpine orogenesis (di Paola & Spalla, 2000). The Sommafiume pegmatite shows features and paragenesis similar to the ones observed at Olgiasca-Malpensata.
Cartography: IGM F 17 II N E
To get to the mine, take the road from Dervio to Sueglio, then for Sommafiume, then the path slightly leading down to a wide hairpin turn where you find the mine.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| β 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) References: |
| β Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| β Beryl Formula: Be3Al2(Si6O18) References: |
| β 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 References: |
| β 'Chlorite Group' References: |
| β 'Columbite-(Fe)-Columbite-(Mn) Series' |
| β Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| β 'Feldspar Group' References: |
| β 'Garnet Group' Formula: X3Z2(SiO4)3 |
| β Goethite Formula: Ξ±-Fe3+O(OH) Description: Tiny inclusion in pegmatite References: |
| β Graftonite Formula: Fe2+Fe2+2(PO4)2 References: |
| β 'Limonite' |
| β Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O References: |
| β 'Monazite' Formula: REE(PO4) References: |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| β Orthoclase Formula: K(AlSi3O8) |
| β Pyrite Formula: FeS2 References: |
| β Pyrrhotite Formula: Fe1-xS References: |
| β Quartz Formula: SiO2 References: |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| β Spessartine Formula: Mn2+3Al2(SiO4)3 References: |
| β Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| β 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| β Triphylite Formula: LiFe2+PO4 |
| β Uraninite Formula: UO2 References: |
| β Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O References: |
| β Zircon Formula: Zr(SiO4) References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| β | Pyrrhotite | 2.CC.10 | Fe1-xS |
| β | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Goethite | 4.00. | Ξ±-Fe3+O(OH) |
| β | Quartz | 4.DA.05 | SiO2 |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Triphylite | 8.AB.10 | LiFe2+PO4 |
| β | Graftonite | 8.AB.20 | Fe2+Fe2+2(PO4)2 |
| β | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 Β· 8H2O |
| β | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 Β· 12H2O |
| β | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 Β· 10-12H2O |
| β | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 Β· 8H2O |
| Group 9 - Silicates | |||
| β | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| β | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| β | 'Feldspar Group' | - | |
| β | 'Limonite' | - | |
| β | 'Monazite' | - | REE(PO4) |
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Chlorite Group' | - | |
| β | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Goethite | Ξ±-Fe3+O(OH) |
| H | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | β Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | β Almandine | Fe32+Al2(SiO4)3 |
| O | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Goethite | Ξ±-Fe3+O(OH) |
| O | β Graftonite | Fe2+Fe22+(PO4)2 |
| O | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | β Monazite | REE(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Orthoclase | K(AlSi3O8) |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Spessartine | Mn32+Al2(SiO4)3 |
| O | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Triphylite | LiFe2+PO4 |
| O | β Uraninite | UO2 |
| O | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | β Zircon | Zr(SiO4) |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Almandine | Fe32+Al2(SiO4)3 |
| Al | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Orthoclase | K(AlSi3O8) |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | Silicon | |
| Si | β Almandine | Fe32+Al2(SiO4)3 |
| Si | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Orthoclase | K(AlSi3O8) |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spessartine | Mn32+Al2(SiO4)3 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | β Graftonite | Fe2+Fe22+(PO4)2 |
| P | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | β Monazite | REE(PO4) |
| P | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | β Triphylite | LiFe2+PO4 |
| P | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Pyrite | FeS2 |
| S | β Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | β Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | β Almandine | Fe32+Al2(SiO4)3 |
| Fe | β Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | β Goethite | Ξ±-Fe3+O(OH) |
| Fe | β Graftonite | Fe2+Fe22+(PO4)2 |
| Fe | β Pyrite | FeS2 |
| Fe | β Pyrrhotite | Fe1-xS |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Triphylite | LiFe2+PO4 |
| Fe | β Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Cu | Copper | |
| Cu | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| U | Uranium | |
| U | β Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | β Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | β Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | β Uraninite | UO2 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Sommafiume pegmatitic dyke, Dorio, Lecco Province, Lombardy, Italy