Covide quarry, Covide, Terras de Bouro, Braga, Portugali
| Regional Level Types | |
|---|---|
| Covide quarry | Quarry (Abandoned) |
| Covide | Civil Parish |
| Terras de Bouro | Municipality |
| Braga | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
41° 43' 53'' North , 8° 12' 45'' West
Latitude & Longitude (decimal):
Type:
Quarry (Abandoned) - last checked 2022
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Goães | 557 (2018) | 11.4km |
| Vieira do Minho | 1,687 (2018) | 12.4km |
| Aboim da Nóbrega | 987 (2013) | 15.0km |
| Sande | 7,789 (2018) | 15.3km |
| Caldelas | 5,724 (2014) | 15.5km |
Mindat Locality ID:
245653
Long-form identifier:
mindat:1:2:245653:2
GUID (UUID V4):
abd4c3b8-367a-4d76-84cc-b3d7f9d760f3
Name(s) in local language(s):
Pedreira de Covide, Covide, Terras de Bouro, Distrito de Braga, Portugal
Pegmatite, abandoned feldspar quarry.
The Covide pegmatite, (Northern Portugal), exhibit a new example of K-feldspar, Albite, quartz layering. The present study leads to propose a magmatic petrogenetit model, with double diffusive processe in temperature gradient allowing the simultaneous growth of millimetric and horizontal »floating layers« of albite. Each cell, unit-phenomenon between two consecutive boundary layers, evolves in closed system with a centripetal, oriented crystallization. The layered organisation is obtaind in the magmatic liquid medium (abstract).
In: Gouanvic, Y., Gagny, C. Contribution à l'étude des litages pegmatitiques: l'exemple de la pegmatite de Covide (Nord-Portugal). Geol Rundsch 76, 125–135 (1987). https://doi.org/10.1007/BF01820577
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ Euclase Formula: BeAl(SiO4)(OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Gadolinite' |
| ⓘ Goethite Formula: α-Fe3+O(OH) References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'K Feldspar' |
| ⓘ 'Limonite' References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Monazite' Formula: REE(PO4) |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ 'Xenotime' |
| ⓘ Zircon Formula: Zr(SiO4) References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | α-Fe3+O(OH) |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Monazite' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Gadolinite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Goethite | α-Fe3+O(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | α-Fe3+O(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite | REE(PO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite | REE(PO4) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Goethite | α-Fe3+O(OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
