Santa Elena pegmatite, El Quemado mining district, La Poma Department, Salta Province, Argentinai
| Regional Level Types | |
|---|---|
| Santa Elena pegmatite | Pegmatite |
| El Quemado mining district | Mining District |
| La Poma Department | Department |
| Salta Province | Province |
| Argentina | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
24° 49' 47'' South , 66° 20' 6'' West
Latitude & Longitude (decimal):
Type:
KΓΆppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| CachΓ | 2,189 (2015) | 36.5km |
| Santa Rosa de Tastil | 2,000 (2016) | 55.6km |
Mindat Locality ID:
242763
Long-form identifier:
mindat:1:2:242763:1
GUID (UUID V4):
52e66e07-8b70-4525-aeeb-604d18ec3dc5
Name(s) in local language(s):
Pegmatita Santa Elena, Distrito de El Quemado, Nevados de Palermo, Salta, Argentina
This pegmatite main minerals are quartz, plagioclase, microcline, to which is added Spodumene, Muscovite, Biotite, Beryl, Lepidolite, Tourmaline, Sphalerite, Molybdenite, Uraninite, Niobite, Tantalite, Native Bismuth, Bismuthinite, Ferrotapiolite, Manganotantalite, Microlite, Uranomicrolite, Bismuthmicrolite, Hafniferous Zircon, Triplite, Montebrasite and other phosphates and uranium oxide minerals.
Minerals of the columbite group have varying compositions: from Ferrocolumbite to Manganocolumbite and the less evolved pegmatites and Shales to Manganotantalite in "Santa Elena". In this case, Microlite, Uranomicrolite, and occasionally Bismuth-Microlite often accompany the most advanced members. Ferrocolumbite was determined by chemistry and x-ray diffraction.
The crystals are centimetric to millimetric, tabular, sub to euhedrales, with development of forms {010}, {100}, {110}, {130}, {011}, {111} in different combinations. Found in the intermediate areas, including in plagioclase, microcline or primary phosphates. Alluvial crystals are prismatic or tabular thicknesses and often have vertical striations. They are black, fragile and have metallic sheen to submetallic.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities23 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Sphalerite | 2.CB.05a | ZnS |
| β | Bismuthinite | 2.DB.05 | Bi2S3 |
| Group 3 - Halides | |||
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| β | Gahnite | 4.BB.05 | ZnAl2O4 |
| β | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| β | 4.DA.05 | SiO2 | |
| β | Uraninite | 4.DL.05 | UO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Triphylite | 8.AB.10 | LiFe2+PO4 |
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| β | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| β | Amblygonite | 8.BB.05 | LiAl(PO4)F |
| β | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| Group 9 - Silicates | |||
| β | Zircon | 9.AD.30 | Zr(SiO4) |
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Spodumene | 9.DA.30 | LiAlSi2O6 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Trilithionite | 9.EC.20 | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| β | Polylithionite | 9.EC.20 | KLi2Al(Si4O10)(F,OH)2 |
| β | Chamosite | 9.EC.55 | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| β | Microcline | 9.FA.30 | K(AlSi3O8) |
| β | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| β | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| β | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| β | 'Lepidolite' | - | |
| β | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| β | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| β | 'Garnet Group' | - | X3Z2(SiO4)3 |
| β | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| H | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Montebrasite | LiAl(PO4)(OH) |
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| H | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | β Amblygonite | LiAl(PO4)F |
| Li | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | β Montebrasite | LiAl(PO4)(OH) |
| Li | β Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Li | β Spodumene | LiAlSi2O6 |
| Li | β Triphylite | LiFe2+PO4 |
| Li | β Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | β Albite | Na(AlSi3O8) |
| O | β Amblygonite | LiAl(PO4)F |
| O | β Quartz var. Amethyst | SiO2 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| O | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Gahnite | ZnAl2O4 |
| O | β Microcline | K(AlSi3O8) |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Montebrasite | LiAl(PO4)(OH) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Spodumene | LiAlSi2O6 |
| O | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | β Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | β Triphylite | LiFe2+PO4 |
| O | β Triplite | Mn22+(PO4)F |
| O | β Uraninite | UO2 |
| O | β Zircon | Zr(SiO4) |
| O | β Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| O | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | β Garnet Group | X3Z2(SiO4)3 |
| O | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | β Amblygonite | LiAl(PO4)F |
| F | β Fluorite | CaF2 |
| F | β Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| F | β Triplite | Mn22+(PO4)F |
| F | β Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| F | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | β Albite | Na(AlSi3O8) |
| Na | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | Aluminium | |
| Al | β Albite | Na(AlSi3O8) |
| Al | β Amblygonite | LiAl(PO4)F |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Al | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Gahnite | ZnAl2O4 |
| Al | β Microcline | K(AlSi3O8) |
| Al | β Montebrasite | LiAl(PO4)(OH) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Spodumene | LiAlSi2O6 |
| Al | β Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Al | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | β Albite | Na(AlSi3O8) |
| Si | β Quartz var. Amethyst | SiO2 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Si | β Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Microcline | K(AlSi3O8) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Spodumene | LiAlSi2O6 |
| Si | β Zircon | Zr(SiO4) |
| Si | β Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Si | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | β Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | β Amblygonite | LiAl(PO4)F |
| P | β Monazite-(Ce) | Ce(PO4) |
| P | β Montebrasite | LiAl(PO4)(OH) |
| P | β Triphylite | LiFe2+PO4 |
| P | β Triplite | Mn22+(PO4)F |
| P | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | β Bismuthinite | Bi2S3 |
| S | β Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | β Microcline | K(AlSi3O8) |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | β Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| K | β Trilithionite | K(Li1.5Al1.5)(AlSi3O10)(F,OH)2 |
| Ca | Calcium | |
| Ca | β Fluorite | CaF2 |
| Ca | β Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | β Apatite | Ca5(PO4)3(Cl/F/OH) |
| Mn | Manganese | |
| Mn | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | β Triplite | Mn22+(PO4)F |
| Fe | Iron | |
| Fe | β Chamosite | (Fe2+)5Al(Si,Al)4O10(OH,O)8 |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | β Triphylite | LiFe2+PO4 |
| Zn | Zinc | |
| Zn | β Gahnite | ZnAl2O4 |
| Zn | β Sphalerite | ZnS |
| Zr | Zirconium | |
| Zr | β Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Ce | Cerium | |
| Ce | β Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | β Microlite Group | A2-mTa2X6-wZ-n |
| Ta | β Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Bi | Bismuth | |
| Bi | β Bismuth | Bi |
| Bi | β Bismuthinite | Bi2S3 |
| U | Uranium | |
| U | β Uraninite | UO2 |
Localities in this Region
- Salta Province
- La Poma Department
- El Quemado mining district
- La Poma Department
Other Regions, Features and Areas containing this locality
Argentina
- Pampean Pegmatite ProvinceMineral Province
South AmericaContinent
- AndesMountain Range
South America PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
