U údražského obrázku quarry, Údraž, Albrechtice nad Vltavou, Písek District, South Bohemian Region, Czech Republici
| Regional Level Types | |
|---|---|
| U údražského obrázku quarry | Quarry (Abandoned) |
| Údraž | Village |
| Albrechtice nad Vltavou | Municipality |
| Písek District | District |
| South Bohemian Region | Region |
| Czech Republic | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
49° 16' 49'' North , 14° 16' 29'' East
Latitude & Longitude (decimal):
Type:
Quarry (Abandoned) - last checked 2021
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Paseky | 141 (2018) | 3.5km |
| Albrechtice nad Vltavou | 822 (2018) | 3.6km |
| Kluky | 515 (2018) | 4.6km |
| Talínské Kukle | 158 (2018) | 5.0km |
| Žďár | 233 (2018) | 6.3km |
Mindat Locality ID:
216206
Long-form identifier:
mindat:1:2:216206:8
GUID (UUID V4):
9eb482a1-db1d-4618-a215-812ab3f2a9ba
Name(s) in local language(s):
U údražského obrázku
Abandoned pegmatite quarry in the forest 2 km west from the village of Údraž. The quarry was opened in 1883.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 References: |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 |
| ⓘ Rutile var. Strüverite Formula: (Ti,Ta,Fe)O2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Strüverite | 4.DB.05 | (Ti,Ta,Fe)O2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ce | Cerium | |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Rutile var. Strüverite | (Ti,Ta,Fe)O2 |
Other Regions, Features and Areas containing this locality
Czech Republic
- ⭔Bohemia (Böhmen; Boehmen)Region
CzechoslovakiaCountry
Eurasian PlateTectonic Plate
EuropeContinent
- Bohemian MassifMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
