Bergsig Farm 167, Omaruru Constituency, Erongo Region, Namibiai
| Regional Level Types | |
|---|---|
| Bergsig Farm 167 | Farm |
| Omaruru Constituency | Constituency |
| Erongo Region | Region |
| Namibia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Mindat Locality ID:
214317
Long-form identifier:
mindat:1:2:214317:3
GUID (UUID V4):
84ce0e88-cc3c-4a5b-840f-2f093dba8cef
Other/historical names associated with this locality:
Hohenstein
The Hohenstein is the tallest peak (2319Β m) in the Erongo complex situated in the south on Bergsig Farm 167, Omaruru District.
In 2000 the best aquamarine crystals in Namibia were discovered in near-vertical granite cliffs below the Hohenstein.
Specimens labelled Hohenstein are erroneous, as no minerals are found on the mountain itself, see https://www.mindat.org/mesg-178564.html
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Beryl Formula: Be3Al2(Si6O18) |
| β Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| β Beryl var. Goshenite Formula: Be3Al2(Si6O18) |
| β 'Feldspar Group' |
| β Fluorite Formula: CaF2 |
| β 'K Feldspar' References: Russ Rizzo CollectionIdentified by Russ Rizzo: Visual Identification, Dealer/Collection Label |
| β Monazite-(Ce) Formula: Ce(PO4) Description: Very small red-brown crystals. A few reddish-brown twinned crystals to 1cm where found with uranium minerals of the autunite group from miaroles 5 km east of Tubussis, Erongorus-Bergsig area. |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| β Quartz Formula: SiO2 |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β Topaz Formula: Al2(SiO4)(F,OH)2 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| β | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Quartz | 4.DA.05 | SiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| β | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| β | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| β | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| β | 9.CJ.05 | Be3Al2(Si6O18) | |
| β | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| β | 'Feldspar Group' | - | |
| β | 'K Feldspar' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | β Topaz | Al2(SiO4)(F,OH)2 |
| Be | Beryllium | |
| Be | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | β Beryl | Be3Al2(Si6O18) |
| Be | β Beryl var. Goshenite | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Monazite-(Ce) | Ce(PO4) |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Topaz | Al2(SiO4)(F,OH)2 |
| O | β Beryl var. Goshenite | Be3Al2(Si6O18) |
| F | Fluorine | |
| F | β Fluorite | CaF2 |
| F | β Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | β Beryl | Be3Al2(Si6O18) |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Topaz | Al2(SiO4)(F,OH)2 |
| Al | β Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | β Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Topaz | Al2(SiO4)(F,OH)2 |
| Si | β Beryl var. Goshenite | Be3Al2(Si6O18) |
| P | Phosphorus | |
| P | β Monazite-(Ce) | Ce(PO4) |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | β Fluorite | CaF2 |
| Fe | Iron | |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ce | Cerium | |
| Ce | β Monazite-(Ce) | Ce(PO4) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Bergsig Farm 167, Omaruru Constituency, Erongo Region, Namibia