Syuigachan Sn-W occurrence, Badzhalski ore District, Khabarovsk Krai, Russiai
| Regional Level Types | |
|---|---|
| Syuigachan Sn-W occurrence | Occurrence |
| Badzhalski ore District | District |
| Khabarovsk Krai | Krai |
| Russia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° North , 134° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~4km
Locality type:
KΓΆppen climate type:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| β Beryl Formula: Be3Al2(Si6O18) Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Bismuth Formula: Bi Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Bismuthinite Formula: Bi2S3 Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Bismutite Formula: (BiO)2CO3 Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Cassiterite Formula: SnO2 Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Eulytine Formula: Bi4(SiO4)3 Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Gold Formula: Au Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Ingodite Formula: Bi2TeS Reference: Pavel M. Kartashov data |
| β 'JosΓ©ite-C' Formula: Bi16Te3S9 Reference: Pavel M. Kartashov data |
| β Molybdenite Formula: MoS2 Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Muscovite Formula: KAl2(AlSi3O10)(OH)2 Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Quartz Formula: SiO2 Reference: P.M. Kartashov and V.V. Strekopytov data |
| β Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Reference: P.M. Kartashov and V.V. Strekopytov data |
| β 'Wolframite Group' Reference: P.M. Kartashov and V.V. Strekopytov data |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| β | Bismuth | 1.CA.05 | Bi |
| β | Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| β | Bismuthinite | 2.DB.05 | Bi2S3 |
| β | Ingodite | 2.DC.05 | Bi2TeS |
| β | 'JosΓ©ite-C' | 2.DC.05 | Bi16Te3S9 |
| β | Molybdenite | 2.EA.30 | MoS2 |
| Group 4 - Oxides and Hydroxides | |||
| β | Cassiterite | 4.DB.05 | SnO2 |
| β | Quartz | 4.DA.05 | SiO2 |
| β | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| β | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 9 - Silicates | |||
| β | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| β | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| β | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| β | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | β Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | β Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | β Quartz | SiO2 |
| O | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | β Bismutite | (BiO)2CO3 |
| O | β Beryl | Be3Al2(Si6O18) |
| O | β Cassiterite | SnO2 |
| O | β Eulytine | Bi4(SiO4)3 |
| Na | Sodium | |
| Na | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | β Beryl | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | β Quartz | SiO2 |
| Si | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | β Beryl | Be3Al2(Si6O18) |
| Si | β Eulytine | Bi4(SiO4)3 |
| S | Sulfur | |
| S | β Bismuthinite | Bi2S3 |
| S | β Molybdenite | MoS2 |
| S | β JosΓ©ite-C | Bi16Te3S9 |
| S | β Ingodite | Bi2TeS |
| K | Potassium | |
| K | β Muscovite | KAl2(AlSi3O10)(OH)2 |
| Fe | Iron | |
| Fe | β Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mo | Molybdenum | |
| Mo | β Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | β Cassiterite | SnO2 |
| Te | Tellurium | |
| Te | β JosΓ©ite-C | Bi16Te3S9 |
| Te | β Ingodite | Bi2TeS |
| Au | Gold | |
| Au | β Gold | Au |
| Bi | Bismuth | |
| Bi | β Bismutite | (BiO)2CO3 |
| Bi | β Bismuth | Bi |
| Bi | β Bismuthinite | Bi2S3 |
| Bi | β Eulytine | Bi4(SiO4)3 |
| Bi | β JosΓ©ite-C | Bi16Te3S9 |
| Bi | β Ingodite | Bi2TeS |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Syuigachan Sn-W occurrence, Badzhalski ore District, Khabarovsk Krai, Russia